C22H21Cl2NO3S — CID 39906022
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,6-dichlorophenyl)sulfanylacetate (PubChem CID 39906022) has the molecular formula C22H21Cl2NO3S and a molecular weight of 450.39 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,6-dichlorophenyl)sulfanylacetate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,6-dichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 39906022 |
| Molecular Formula | C22H21Cl2NO3S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,6-dichlorophenyl)sulfanylacetate |
| SMILES | CN1/C(=C\C(=O)COC(=O)CSc2c(Cl)cccc2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H21Cl2NO3S/c1-22(2)15-7-4-5-10-18(15)25(3)19(22)11-14(26)12-28-20(27)13-29-21-16(23)8-6-9-17(21)24/h4-11H,12-13H2,1-3H3/b19-11- |
| InChIKey | YPUXCXBRZCSFRL-ODLFYWEKSA-N |
| XLogP | 5.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|