C24H27NO3S — CID 23796798
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,5-dimethylphenyl)sulfanylacetate (PubChem CID 23796798) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,5-dimethylphenyl)sulfanylacetate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,5-dimethylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 23796798 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,5-dimethylphenyl)sulfanylacetate |
| SMILES | Cc1ccc(C)c(SCC(=O)OCC(=O)C=C2N(C)c3ccccc3C2(C)C)c1 |
| InChI | InChI=1S/C24H27NO3S/c1-16-10-11-17(2)21(12-16)29-15-23(27)28-14-18(26)13-22-24(3,4)19-8-6-7-9-20(19)25(22)5/h6-13H,14-15H2,1-5H3 |
| InChIKey | QMZGHIDUWURSJC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|