C30H29ClN2O4 — CID 2484711
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3S)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 2484711) has the molecular formula C30H29ClN2O4 and a molecular weight of 517.03 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3S)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3S)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 2484711 |
| Molecular Formula | C30H29ClN2O4 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3S)-3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | CN1/C(=C\C(=O)COC(=O)C[C@H](NC(=O)c2ccccc2Cl)c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H29ClN2O4/c1-30(2)23-14-8-10-16-26(23)33(3)27(30)17-21(34)19-37-28(35)18-25(20-11-5-4-6-12-20)32-29(36)22-13-7-9-15-24(22)31/h4-17,25H,18-19H2,1-3H3,(H,32,36)/b27-17-/t25-/m0/s1 |
| InChIKey | BMUKFZIPJFRJPJ-RWJNZEQESA-N |
| XLogP | 5.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|