C30H23ClN2O4S — CID 4043095
(2-oxo-2-phenothiazin-10-ylethyl) 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 4043095) has the molecular formula C30H23ClN2O4S and a molecular weight of 543.04 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 4043095 |
| Molecular Formula | C30H23ClN2O4S |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | O=C(CC(NC(=O)c1ccccc1Cl)c1ccccc1)OCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C30H23ClN2O4S/c31-22-13-5-4-12-21(22)30(36)32-23(20-10-2-1-3-11-20)18-29(35)37-19-28(34)33-24-14-6-8-16-26(24)38-27-17-9-7-15-25(27)33/h1-17,23H,18-19H2,(H,32,36) |
| InChIKey | AXCBVHASYRMUQQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |