C27H23ClN2O5 — CID 55373722
3-(1,3-dioxoisoindol-2-yl)propyl 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 55373722) has the molecular formula C27H23ClN2O5 and a molecular weight of 490.94 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 55373722 |
| Molecular Formula | C27H23ClN2O5 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-[(2-chlorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | O=C(CC(NC(=O)c1ccccc1Cl)c1ccccc1)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H23ClN2O5/c28-22-14-7-6-13-21(22)25(32)29-23(18-9-2-1-3-10-18)17-24(31)35-16-8-15-30-26(33)19-11-4-5-12-20(19)27(30)34/h1-7,9-14,23H,8,15-17H2,(H,29,32) |
| InChIKey | UYHANSRCFHHGGH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|