C26H22N2O5 — CID 55460217
3-(1,3-dioxoisoindol-2-yl)propyl 2-benzamido-2-phenylacetate (PubChem CID 55460217) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 2-benzamido-2-phenylacetate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 55460217 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-benzamido-2-phenylacetate |
| SMILES | O=C(NC(C(=O)OCCCN1C(=O)c2ccccc2C1=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O5/c29-23(19-12-5-2-6-13-19)27-22(18-10-3-1-4-11-18)26(32)33-17-9-16-28-24(30)20-14-7-8-15-21(20)25(28)31/h1-8,10-15,22H,9,16-17H2,(H,27,29) |
| InChIKey | VBSDPFRWQGKXPH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|