C25H27N3O5 — CID 3395390
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 3395390) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 3395390 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | CN1C(=CC(=O)COC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H27N3O5/c1-25(2)19-8-4-5-9-20(19)26(3)23(25)15-18(29)16-33-24(30)17-10-11-21(22(14-17)28(31)32)27-12-6-7-13-27/h4-5,8-11,14-15H,6-7,12-13,16H2,1-3H3 |
| InChIKey | ZEDVCFMIUWKRAF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|