C24H23Cl2N3O3 — CID 46817883
5-(2,4-dichlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione (PubChem CID 46817883) has the molecular formula C24H23Cl2N3O3 and a molecular weight of 472.37 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46817883 |
| Molecular Formula | C24H23Cl2N3O3 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione |
| SMILES | CN1/C(=C\C(=O)CN2C(=O)NC(C)(c3ccc(Cl)cc3Cl)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H23Cl2N3O3/c1-23(2)17-7-5-6-8-19(17)28(4)20(23)12-15(30)13-29-21(31)24(3,27-22(29)32)16-10-9-14(25)11-18(16)26/h5-12H,13H2,1-4H3,(H,27,32)/b20-12- |
| InChIKey | UXGAOHIIXWVYBA-NDENLUEZSA-N |
| XLogP | 4.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|