C21H17Cl2N3O3 — CID 2112150
(5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 2112150) has the molecular formula C21H17Cl2N3O3 and a molecular weight of 430.29 g/mol. Its IUPAC name is (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2112150 |
| Molecular Formula | C21H17Cl2N3O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | (5S)-5-(2,4-dichlorophenyl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C21H17Cl2N3O3/c1-11-18(13-5-3-4-6-16(13)24-11)17(27)10-26-19(28)21(2,25-20(26)29)14-8-7-12(22)9-15(14)23/h3-9,24H,10H2,1-2H3,(H,25,29)/t21-/m0/s1 |
| InChIKey | HOBBEEBWMMWPBH-NRFANRHFSA-N |
| XLogP | 4.43 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|