C19H17N3O4 — CID 9451712
(5R)-5-(furan-2-yl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 9451712) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (5R)-5-(furan-2-yl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(furan-2-yl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9451712 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (5R)-5-(furan-2-yl)-5-methyl-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN1C(=O)N[C@](C)(c2ccco2)C1=O |
| InChI | InChI=1S/C19H17N3O4/c1-11-16(12-6-3-4-7-13(12)20-11)14(23)10-22-17(24)19(2,21-18(22)25)15-8-5-9-26-15/h3-9,20H,10H2,1-2H3,(H,21,25)/t19-/m1/s1 |
| InChIKey | QSAHNFPQAAUHRT-LJQANCHMSA-N |
| XLogP | 2.72 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|