C19H12Cl2N2O3 — CID 7880189
5,6-dichloro-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 7880189) has the molecular formula C19H12Cl2N2O3 and a molecular weight of 387.22 g/mol. Its IUPAC name is 5,6-dichloro-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7880189 |
| Molecular Formula | C19H12Cl2N2O3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 5,6-dichloro-2-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C19H12Cl2N2O3/c1-9-17(10-4-2-3-5-15(10)22-9)16(24)8-23-18(25)11-6-13(20)14(21)7-12(11)19(23)26/h2-7,22H,8H2,1H3 |
| InChIKey | UGAPPXHTOLKKCB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|