C26H20ClN3O3 — CID 2418759
1-benzyl-6-chloro-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]quinoxaline-2,3-dione (PubChem CID 2418759) has the molecular formula C26H20ClN3O3 and a molecular weight of 457.92 g/mol. Its IUPAC name is 1-benzyl-6-chloro-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]quinoxaline-2,3-dione.
| Compound Name | 1-benzyl-6-chloro-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 2418759 |
| Molecular Formula | C26H20ClN3O3 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1-benzyl-6-chloro-4-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]quinoxaline-2,3-dione |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)Cn1c(=O)c(=O)n(Cc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H20ClN3O3/c1-16-24(19-9-5-6-10-20(19)28-16)23(31)15-30-22-13-18(27)11-12-21(22)29(25(32)26(30)33)14-17-7-3-2-4-8-17/h2-13,28H,14-15H2,1H3 |
| InChIKey | UYDYGETWOMXCRN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|