C30H26ClN3O3 — CID 2485040
1-benzyl-6-chloro-4-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]quinoxaline-2,3-dione (PubChem CID 2485040) has the molecular formula C30H26ClN3O3 and a molecular weight of 512.01 g/mol. Its IUPAC name is 1-benzyl-6-chloro-4-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]quinoxaline-2,3-dione.
| Compound Name | 1-benzyl-6-chloro-4-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 2485040 |
| Molecular Formula | C30H26ClN3O3 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 1-benzyl-6-chloro-4-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]quinoxaline-2,3-dione |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)Cn3c(=O)c(=O)n(Cc4ccccc4)c4ccc(Cl)cc43)c2C)cc1 |
| InChI | InChI=1S/C30H26ClN3O3/c1-19-9-12-24(13-10-19)34-20(2)15-25(21(34)3)28(35)18-33-27-16-23(31)11-14-26(27)32(29(36)30(33)37)17-22-7-5-4-6-8-22/h4-16H,17-18H2,1-3H3 |
| InChIKey | SXRFTKHWYBGZAC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|