C29H24FN3O2S — CID 4214664
3-benzyl-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 4214664) has the molecular formula C29H24FN3O2S and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-benzyl-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-benzyl-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 4214664 |
| Molecular Formula | C29H24FN3O2S |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 3-benzyl-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | Cc1cc(C(=O)CSc2nc3ccccc3c(=O)n2Cc2ccccc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H24FN3O2S/c1-19-16-25(20(2)33(19)23-14-12-22(30)13-15-23)27(34)18-36-29-31-26-11-7-6-10-24(26)28(35)32(29)17-21-8-4-3-5-9-21/h3-16H,17-18H2,1-2H3 |
| InChIKey | MLXDKLINLFONOZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|