C27H28FN3O3S — CID 3646935
3-(3-ethoxypropyl)-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 3646935) has the molecular formula C27H28FN3O3S and a molecular weight of 493.60 g/mol. Its IUPAC name is 3-(3-ethoxypropyl)-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(3-ethoxypropyl)-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 3646935 |
| Molecular Formula | C27H28FN3O3S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 3-(3-ethoxypropyl)-2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | CCOCCCn1c(SCC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H28FN3O3S/c1-4-34-15-7-14-30-26(33)22-8-5-6-9-24(22)29-27(30)35-17-25(32)23-16-18(2)31(19(23)3)21-12-10-20(28)11-13-21/h5-6,8-13,16H,4,7,14-15,17H2,1-3H3 |
| InChIKey | VANROPYDDMOAMJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|