C27H29N3O3S — CID 3946686
3-butyl-2-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 3946686) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 3-butyl-2-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-butyl-2-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 3946686 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 3-butyl-2-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | CCCCn1c(SCC(=O)c2cc(C)n(-c3ccc(OC)cc3)c2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H29N3O3S/c1-5-6-15-29-26(32)22-9-7-8-10-24(22)28-27(29)34-17-25(31)23-16-18(2)30(19(23)3)20-11-13-21(33-4)14-12-20/h7-14,16H,5-6,15,17H2,1-4H3 |
| InChIKey | UVMZSAXESSLYMR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|