C21H20Cl2N2O — CID 4680505
1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-chlorophenyl)methylamino]ethanone (PubChem CID 4680505) has the molecular formula C21H20Cl2N2O and a molecular weight of 387.31 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-chlorophenyl)methylamino]ethanone.
| Compound Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-chlorophenyl)methylamino]ethanone |
|---|---|
| PubChem CID | 4680505 |
| Molecular Formula | C21H20Cl2N2O |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-chlorophenyl)methylamino]ethanone |
| SMILES | Cc1cc(C(=O)CNCc2ccc(Cl)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O/c1-14-11-20(15(2)25(14)19-9-7-18(23)8-10-19)21(26)13-24-12-16-3-5-17(22)6-4-16/h3-11,24H,12-13H2,1-2H3 |
| InChIKey | MNRZJCTULAOGNT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|