C19H23ClN2O — CID 148921903
1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-piperidin-4-ylethanone (PubChem CID 148921903) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-piperidin-4-ylethanone.
| Compound Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 148921903 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-piperidin-4-ylethanone |
| SMILES | Cc1cc(C(=O)CC2CCNCC2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN2O/c1-13-11-18(19(23)12-15-7-9-21-10-8-15)14(2)22(13)17-5-3-16(20)4-6-17/h3-6,11,15,21H,7-10,12H2,1-2H3 |
| InChIKey | PKFWECFFKUDGCV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|