C17H18ClN3O — CID 71006969
1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4,5-dihydroimidazol-1-yl)ethanone (PubChem CID 71006969) has the molecular formula C17H18ClN3O and a molecular weight of 315.80 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4,5-dihydroimidazol-1-yl)ethanone.
| Compound Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4,5-dihydroimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 71006969 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(4,5-dihydroimidazol-1-yl)ethanone |
| SMILES | Cc1cc(C(=O)CN2C=NCC2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O/c1-12-9-16(17(22)10-20-8-7-19-11-20)13(2)21(12)15-5-3-14(18)4-6-15/h3-6,9,11H,7-8,10H2,1-2H3 |
| InChIKey | LDAFSCQCWZIORF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|