C20H24ClFN3O2+ — CID 9276195
2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 9276195) has the molecular formula C20H24ClFN3O2+ and a molecular weight of 392.88 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 9276195 |
| Molecular Formula | C20H24ClFN3O2+ |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | CC(=O)N1CC[NH+](CC(=O)c2cc(C)n(-c3ccc(F)c(Cl)c3)c2C)CC1 |
| InChI | InChI=1S/C20H23ClFN3O2/c1-13-10-17(14(2)25(13)16-4-5-19(22)18(21)11-16)20(27)12-23-6-8-24(9-7-23)15(3)26/h4-5,10-11H,6-9,12H2,1-3H3/p+1 |
| InChIKey | HGTDXAYWNXEDQK-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|