C20H25ClN3O2+ — CID 9276177
2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 9276177) has the molecular formula C20H25ClN3O2+ and a molecular weight of 374.89 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 9276177 |
| Molecular Formula | C20H25ClN3O2+ |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-(4-acetylpiperazin-1-ium-1-yl)-1-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | CC(=O)N1CC[NH+](CC(=O)c2cc(C)n(-c3cccc(Cl)c3)c2C)CC1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-14-11-19(15(2)24(14)18-6-4-5-17(21)12-18)20(26)13-22-7-9-23(10-8-22)16(3)25/h4-6,11-12H,7-10,13H2,1-3H3/p+1 |
| InChIKey | LFERPGLYBXEPKG-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|