C24H27FN3O2+ — CID 2402814
1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethanone (PubChem CID 2402814) has the molecular formula C24H27FN3O2+ and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethanone.
| Compound Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 2402814 |
| Molecular Formula | C24H27FN3O2+ |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]ethanone |
| SMILES | Cc1cc(C(=O)C[NH+]2CCN(c3ccc(O)cc3)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN3O2/c1-17-15-23(18(2)28(17)21-5-3-19(25)4-6-21)24(30)16-26-11-13-27(14-12-26)20-7-9-22(29)10-8-20/h3-10,15,29H,11-14,16H2,1-2H3/p+1 |
| InChIKey | CTBNRWIXQPEKDX-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 49.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|