C24H25F2N3O — CID 45017241
1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 45017241) has the molecular formula C24H25F2N3O and a molecular weight of 409.48 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 45017241 |
| Molecular Formula | C24H25F2N3O |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(C(=O)CN2CCN(c3ccccc3F)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25F2N3O/c1-17-15-21(18(2)29(17)20-9-7-19(25)8-10-20)24(30)16-27-11-13-28(14-12-27)23-6-4-3-5-22(23)26/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | WPVLMQHDZIGVRY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|