C20H25FN2O — CID 5067339
1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(3-methylpiperidin-1-yl)ethanone (PubChem CID 5067339) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(3-methylpiperidin-1-yl)ethanone.
| Compound Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(3-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 5067339 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(3-methylpiperidin-1-yl)ethanone |
| SMILES | Cc1cc(C(=O)CN2CCCC(C)C2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O/c1-14-5-4-10-22(12-14)13-20(24)19-11-15(2)23(16(19)3)18-8-6-17(21)7-9-18/h6-9,11,14H,4-5,10,12-13H2,1-3H3 |
| InChIKey | YROVKHWEZGOCDG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|