C22H29N3O2 — CID 53355925
4-[3-[2-(3,5-dimethylpiperidin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzamide (PubChem CID 53355925) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-[3-[2-(3,5-dimethylpiperidin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzamide.
| Compound Name | 4-[3-[2-(3,5-dimethylpiperidin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 53355925 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-[3-[2-(3,5-dimethylpiperidin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzamide |
| SMILES | Cc1cc(C(=O)CN2CC(C)CC(C)C2)c(C)n1-c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-14-9-15(2)12-24(11-14)13-21(26)20-10-16(3)25(17(20)4)19-7-5-18(6-8-19)22(23)27/h5-8,10,14-15H,9,11-13H2,1-4H3,(H2,23,27) |
| InChIKey | UPHNRHUUGLOYTF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|