C18H17ClFN3O3 — CID 9465783
3-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 9465783) has the molecular formula C18H17ClFN3O3 and a molecular weight of 377.80 g/mol. Its IUPAC name is 3-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9465783 |
| Molecular Formula | C18H17ClFN3O3 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)CN(C)C2=O)c(C)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClFN3O3/c1-10-6-13(16(24)8-22-17(25)9-21(3)18(22)26)11(2)23(10)12-4-5-15(20)14(19)7-12/h4-7H,8-9H2,1-3H3 |
| InChIKey | PRGQZAIFYCTRHE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|