C21H23N3O3 — CID 87022827
1-cyclopropyl-3-[2-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 87022827) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 1-cyclopropyl-3-[2-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87022827 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-cyclopropyl-3-[2-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(-n2c(C)cc(C(=O)CN3C(=O)CN(C4CC4)C3=O)c2C)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-13-5-4-6-17(9-13)24-14(2)10-18(15(24)3)19(25)11-23-20(26)12-22(21(23)27)16-7-8-16/h4-6,9-10,16H,7-8,11-12H2,1-3H3 |
| InChIKey | OBSSCQGFWNYFTN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|