C26H23ClFN3O3 — CID 55304566
3'-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 55304566) has the molecular formula C26H23ClFN3O3 and a molecular weight of 479.94 g/mol. Its IUPAC name is 3'-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 55304566 |
| Molecular Formula | C26H23ClFN3O3 |
| Molecular Weight | 479.94 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3'-[2-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)NC3(CCc4ccccc4C3)C2=O)c(C)n1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C26H23ClFN3O3/c1-15-11-20(16(2)31(15)19-7-8-22(28)21(27)12-19)23(32)14-30-24(33)26(29-25(30)34)10-9-17-5-3-4-6-18(17)13-26/h3-8,11-12H,9-10,13-14H2,1-2H3,(H,29,34) |
| InChIKey | RXPVQABCLRNDSO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.94 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|