C25H22ClN3O3 — CID 41084068
(3R)-3'-[2-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 41084068) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is (3R)-3'-[2-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3R)-3'-[2-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41084068 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (3R)-3'-[2-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)N[C@@]3(CCc4ccccc43)C2=O)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H22ClN3O3/c1-15-12-20(16(2)29(15)19-8-5-7-18(26)13-19)22(30)14-28-23(31)25(27-24(28)32)11-10-17-6-3-4-9-21(17)25/h3-9,12-13H,10-11,14H2,1-2H3,(H,27,32)/t25-/m1/s1 |
| InChIKey | NIBUNOGDNFGHKU-RUZDIDTESA-N |
| XLogP | 4.32 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|