C32H31N5O6 — CID 98416257
[2-[1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetate (PubChem CID 98416257) has the molecular formula C32H31N5O6 and a molecular weight of 581.63 g/mol. Its IUPAC name is [2-[1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetate.
| Compound Name | [2-[1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetate |
|---|---|
| PubChem CID | 98416257 |
| Molecular Formula | C32H31N5O6 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | [2-[1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetate |
| SMILES | Cc1cc(C(=O)COC(=O)CN2C(=O)N[C@]3(CCc4ccccc43)C2=O)c(C)n1-c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C32H31N5O6/c1-19-16-24(20(2)36(19)28-21(3)34(4)37(29(28)40)23-11-6-5-7-12-23)26(38)18-43-27(39)17-35-30(41)32(33-31(35)42)15-14-22-10-8-9-13-25(22)32/h5-13,16H,14-15,17-18H2,1-4H3,(H,33,42)/t32-/m0/s1 |
| InChIKey | ARSWFJPFAIHBKO-YTTGMZPUSA-N |
| XLogP | 3.01 |
| TPSA | 124.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|