C25H29Cl2N3O3 — CID 2089078
(5R,9R)-3-[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2089078) has the molecular formula C25H29Cl2N3O3 and a molecular weight of 490.43 g/mol. Its IUPAC name is (5R,9R)-3-[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,9R)-3-[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2089078 |
| Molecular Formula | C25H29Cl2N3O3 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (5R,9R)-3-[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)N[C@@]3(C[C@H](C)CC(C)(C)C3)C2=O)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H29Cl2N3O3/c1-14-10-24(4,5)13-25(11-14)22(32)29(23(33)28-25)12-21(31)18-8-15(2)30(16(18)3)17-6-7-19(26)20(27)9-17/h6-9,14H,10-13H2,1-5H3,(H,28,33)/t14-,25-/m1/s1 |
| InChIKey | DVBBFPXHPPGWEL-DLUDVSRJSA-N |
| XLogP | 5.72 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|