C36H43ClN2O2 — CID 158109107
2-cyclobutylacetyl chloride;2-cyclobutyl-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone;2,5-dimethyl-1-phenylpyrrole (PubChem CID 158109107) has the molecular formula C36H43ClN2O2 and a molecular weight of 571.21 g/mol. Its IUPAC name is 2-cyclobutylacetyl chloride;2-cyclobutyl-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone;2,5-dimethyl-1-phenylpyrrole.
| Compound Name | 2-cyclobutylacetyl chloride;2-cyclobutyl-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone;2,5-dimethyl-1-phenylpyrrole |
|---|---|
| PubChem CID | 158109107 |
| Molecular Formula | C36H43ClN2O2 |
| Molecular Weight | 571.21 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 2-cyclobutylacetyl chloride;2-cyclobutyl-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone;2,5-dimethyl-1-phenylpyrrole |
| SMILES | Cc1cc(C(=O)CC2CCC2)c(C)n1-c1ccccc1.Cc1ccc(C)n1-c1ccccc1.O=C(Cl)CC1CCC1 |
| InChI | InChI=1S/C18H21NO.C12H13N.C6H9ClO/c1-13-11-17(18(20)12-15-7-6-8-15)14(2)19(13)16-9-4-3-5-10-16;1-10-8-9-11(2)13(10)12-6-4-3-5-7-12;7-6(8)4-5-2-1-3-5/h3-5,9-11,15H,6-8,12H2,1-2H3;3-9H,1-2H3;5H,1-4H2 |
| InChIKey | FQEUWAXJKZOKEV-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.21 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|