C19H25N3O — CID 119459788
2,5-dimethyl-1-phenyl-N-(piperidin-3-ylmethyl)pyrrole-3-carboxamide (PubChem CID 119459788) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-N-(piperidin-3-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-phenyl-N-(piperidin-3-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 119459788 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-N-(piperidin-3-ylmethyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2CCCNC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C19H25N3O/c1-14-11-18(15(2)22(14)17-8-4-3-5-9-17)19(23)21-13-16-7-6-10-20-12-16/h3-5,8-9,11,16,20H,6-7,10,12-13H2,1-2H3,(H,21,23) |
| InChIKey | MZEQKSAOSNDSAD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|