C24H27N3O — CID 55678741
2,5-dimethyl-1-phenyl-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrrole-3-carboxamide (PubChem CID 55678741) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-phenyl-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55678741 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2CCN(c3ccccc3)C2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H27N3O/c1-18-15-23(19(2)27(18)22-11-7-4-8-12-22)24(28)25-16-20-13-14-26(17-20)21-9-5-3-6-10-21/h3-12,15,20H,13-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | VDQYZUAEWLPECP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|