C21H22N2O — CID 167781608
3-ethynyl-2-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide (PubChem CID 167781608) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-ethynyl-2-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 3-ethynyl-2-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 167781608 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-ethynyl-2-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide |
| SMILES | C#Cc1cccc(C(=O)NCC2CCN(c3ccccc3)C2)c1C |
| InChI | InChI=1S/C21H22N2O/c1-3-18-8-7-11-20(16(18)2)21(24)22-14-17-12-13-23(15-17)19-9-5-4-6-10-19/h1,4-11,17H,12-15H2,2H3,(H,22,24) |
| InChIKey | VCHWPKYFCSFVJR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|