C17H19N3O2 — CID 46403357
2-oxo-N-[(1-phenylpyrrolidin-3-yl)methyl]-1H-pyridine-3-carboxamide (PubChem CID 46403357) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-oxo-N-[(1-phenylpyrrolidin-3-yl)methyl]-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[(1-phenylpyrrolidin-3-yl)methyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46403357 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-oxo-N-[(1-phenylpyrrolidin-3-yl)methyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCN(c2ccccc2)C1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C17H19N3O2/c21-16-15(7-4-9-18-16)17(22)19-11-13-8-10-20(12-13)14-5-2-1-3-6-14/h1-7,9,13H,8,10-12H2,(H,18,21)(H,19,22) |
| InChIKey | VXVRRHLDPOEXGQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |