C11H15N3O2 — CID 80564171
2-oxo-N-(pyrrolidin-3-ylmethyl)-1H-pyridine-3-carboxamide (PubChem CID 80564171) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-oxo-N-(pyrrolidin-3-ylmethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-(pyrrolidin-3-ylmethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 80564171 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-oxo-N-(pyrrolidin-3-ylmethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCNC1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C11H15N3O2/c15-10-9(2-1-4-13-10)11(16)14-7-8-3-5-12-6-8/h1-2,4,8,12H,3,5-7H2,(H,13,15)(H,14,16) |
| InChIKey | VBPLQCZCEWXEAY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |