C18H20N4O4 — CID 124877536
6-methyl-3-nitro-2-oxo-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]-1H-pyridine-4-carboxamide (PubChem CID 124877536) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 6-methyl-3-nitro-2-oxo-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]-1H-pyridine-4-carboxamide.
| Compound Name | 6-methyl-3-nitro-2-oxo-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 124877536 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 6-methyl-3-nitro-2-oxo-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]-1H-pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC[C@H]2CCN(c3ccccc3)C2)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C18H20N4O4/c1-12-9-15(16(22(25)26)18(24)20-12)17(23)19-10-13-7-8-21(11-13)14-5-3-2-4-6-14/h2-6,9,13H,7-8,10-11H2,1H3,(H,19,23)(H,20,24)/t13-/m1/s1 |
| InChIKey | QWZZNMXWHNDEII-CYBMUJFWSA-N |
| XLogP | 1.85 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|