C22H27N3O3 — CID 46441531
2-[2-(dimethylamino)-2-oxoethoxy]-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide (PubChem CID 46441531) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-oxoethoxy]-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 2-[2-(dimethylamino)-2-oxoethoxy]-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46441531 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[2-(dimethylamino)-2-oxoethoxy]-N-[(1-phenylpyrrolidin-3-yl)methyl]benzamide |
| SMILES | CN(C)C(=O)COc1ccccc1C(=O)NCC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-24(2)21(26)16-28-20-11-7-6-10-19(20)22(27)23-14-17-12-13-25(15-17)18-8-4-3-5-9-18/h3-11,17H,12-16H2,1-2H3,(H,23,27) |
| InChIKey | GUSNUIJOPUFLKB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |