C20H26N3O+ — CID 8717211
2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone (PubChem CID 8717211) has the molecular formula C20H26N3O+ and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone.
| Compound Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 8717211 |
| Molecular Formula | C20H26N3O+ |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)C[N+]23CCN(CC2)CC3)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H26N3O/c1-16-14-19(17(2)22(16)18-6-4-3-5-7-18)20(24)15-23-11-8-21(9-12-23)10-13-23/h3-7,14H,8-13,15H2,1-2H3/q+1 |
| InChIKey | QGTPVDVOAFJJAL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|