C20H21N2O+ — CID 8717605
1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(2-methylpyridin-1-ium-1-yl)ethanone (PubChem CID 8717605) has the molecular formula C20H21N2O+ and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(2-methylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(2-methylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8717605 |
| Molecular Formula | C20H21N2O+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(2-methylpyridin-1-ium-1-yl)ethanone |
| SMILES | Cc1cc(C(=O)C[n+]2ccccc2C)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H21N2O/c1-15-9-7-8-12-21(15)14-20(23)19-13-16(2)22(17(19)3)18-10-5-4-6-11-18/h4-13H,14H2,1-3H3/q+1 |
| InChIKey | YLTOQESHLFCWDA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|