C20H18F2N2O — CID 110654828
2-(2,6-difluoroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone (PubChem CID 110654828) has the molecular formula C20H18F2N2O and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-(2,6-difluoroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone.
| Compound Name | 2-(2,6-difluoroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110654828 |
| Molecular Formula | C20H18F2N2O |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-(2,6-difluoroanilino)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CNc2c(F)cccc2F)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H18F2N2O/c1-13-11-16(14(2)24(13)15-7-4-3-5-8-15)19(25)12-23-20-17(21)9-6-10-18(20)22/h3-11,23H,12H2,1-2H3 |
| InChIKey | NZEQAGLCQPKOLU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|