C13H16O — CID 65460155
2-cyclobutyl-1-(2-methylphenyl)ethanone (PubChem CID 65460155) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-cyclobutyl-1-(2-methylphenyl)ethanone.
| Compound Name | 2-cyclobutyl-1-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 65460155 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-cyclobutyl-1-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1C(=O)CC1CCC1 |
| InChI | InChI=1S/C13H16O/c1-10-5-2-3-8-12(10)13(14)9-11-6-4-7-11/h2-3,5,8,11H,4,6-7,9H2,1H3 |
| InChIKey | JUEPLRDVDNCIEX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |