C15H20O — CID 105102936
1-cyclobutyl-4-(2-methylphenyl)butan-2-one (PubChem CID 105102936) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-cyclobutyl-4-(2-methylphenyl)butan-2-one.
| Compound Name | 1-cyclobutyl-4-(2-methylphenyl)butan-2-one |
|---|---|
| PubChem CID | 105102936 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-cyclobutyl-4-(2-methylphenyl)butan-2-one |
| SMILES | Cc1ccccc1CCC(=O)CC1CCC1 |
| InChI | InChI=1S/C15H20O/c1-12-5-2-3-8-14(12)9-10-15(16)11-13-6-4-7-13/h2-3,5,8,13H,4,6-7,9-11H2,1H3 |
| InChIKey | LHXIWYLZQAGJDT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |