C17H22ClN3O — CID 120826815
1-(4-chlorophenyl)-2,5-dimethyl-N-[2-(methylamino)propyl]pyrrole-3-carboxamide (PubChem CID 120826815) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dimethyl-N-[2-(methylamino)propyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-[2-(methylamino)propyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 120826815 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dimethyl-N-[2-(methylamino)propyl]pyrrole-3-carboxamide |
| SMILES | CNC(C)CNC(=O)c1cc(C)n(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C17H22ClN3O/c1-11(19-4)10-20-17(22)16-9-12(2)21(13(16)3)15-7-5-14(18)6-8-15/h5-9,11,19H,10H2,1-4H3,(H,20,22) |
| InChIKey | KCUJIVSISHZTPO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|