C16H24Cl2N4O — CID 120831614
2,5-dimethyl-N-[2-(methylamino)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride (PubChem CID 120831614) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(methylamino)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride.
| Compound Name | 2,5-dimethyl-N-[2-(methylamino)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120831614 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2,5-dimethyl-N-[2-(methylamino)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
| SMILES | CNC(C)CNC(=O)c1cc(C)n(-c2ccccn2)c1C.Cl.Cl |
| InChI | InChI=1S/C16H22N4O.2ClH/c1-11(17-4)10-19-16(21)14-9-12(2)20(13(14)3)15-7-5-6-8-18-15;;/h5-9,11,17H,10H2,1-4H3,(H,19,21);2*1H |
| InChIKey | MYYWKSXXLUTAMO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|