C17H26Cl2N4O — CID 120654138
N-[(2R)-2-(ethylamino)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride (PubChem CID 120654138) has the molecular formula C17H26Cl2N4O and a molecular weight of 373.33 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120654138 |
| Molecular Formula | C17H26Cl2N4O |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)c1cc(C)n(-c2ccccn2)c1C.Cl.Cl |
| InChI | InChI=1S/C17H24N4O.2ClH/c1-5-18-12(2)11-20-17(22)15-10-13(3)21(14(15)4)16-8-6-7-9-19-16;;/h6-10,12,18H,5,11H2,1-4H3,(H,20,22);2*1H/t12-;;/m1../s1 |
| InChIKey | PFKIGWSLKCTCOP-CURYUGHLSA-N |
| XLogP | 3.06 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|