C17H21N3O3 — CID 119360329
(2S)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 119360329) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119360329 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2S)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | Cc1cc(C(=O)N[C@H](C(=O)O)C(C)C)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C17H21N3O3/c1-10(2)15(17(22)23)19-16(21)13-9-11(3)20(12(13)4)14-7-5-6-8-18-14/h5-10,15H,1-4H3,(H,19,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | TVYULCCEPWLERI-HNNXBMFYSA-N |
| XLogP | 2.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|