C21H24N4O3S — CID 55634814
2,5-dimethyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 55634814) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55634814 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2,5-dimethyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)c2cc(C)n(-c3ccccn3)c2C)cc1 |
| InChI | InChI=1S/C21H24N4O3S/c1-15-7-9-18(10-8-15)29(27,28)24-13-12-23-21(26)19-14-16(2)25(17(19)3)20-6-4-5-11-22-20/h4-11,14,24H,12-13H2,1-3H3,(H,23,26) |
| InChIKey | LZHCQZPZOCNJNT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|