C19H29Cl2N5O — CID 119393360
2,5-dimethyl-N-(3-piperazin-1-ylpropyl)-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride (PubChem CID 119393360) has the molecular formula C19H29Cl2N5O and a molecular weight of 414.38 g/mol. Its IUPAC name is 2,5-dimethyl-N-(3-piperazin-1-ylpropyl)-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride.
| Compound Name | 2,5-dimethyl-N-(3-piperazin-1-ylpropyl)-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119393360 |
| Molecular Formula | C19H29Cl2N5O |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2,5-dimethyl-N-(3-piperazin-1-ylpropyl)-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
| SMILES | Cc1cc(C(=O)NCCCN2CCNCC2)c(C)n1-c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C19H27N5O.2ClH/c1-15-14-17(16(2)24(15)18-6-3-4-7-21-18)19(25)22-8-5-11-23-12-9-20-10-13-23;;/h3-4,6-7,14,20H,5,8-13H2,1-2H3,(H,22,25);2*1H |
| InChIKey | SFJWTZMIPKFTJD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|